BIOPEP-UWM: Report
ID | 3184 |
Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
sequence |
Function: | |||
Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
Number of residues | 2 |
Activity code | dpp |
Activity : | dipeptidyl peptidase IV inhibitor |
|||
Chemical mass | 226.2319 | Monoisotopic mass | 226.1063 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Bella A. M., Erickson R. H. Jr., Kim Y. S. | |
Title | |
Rat intestinal brush border membrane dipeptidyl-aminopeptidase IV:kinetic properties and substrate specifities of the purified enzyme.Arch. Biochem. Biophys. 218, 156-162 (1982) | |
Year | Source |
1982 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CN=C[N]1[H])C(=O)N[C@@H](C)C(=O)O InChI=1S/C9H14N4O3/c1-5(9(15)16)13-8(14)7(10)2-6-3-11-4-12-6/h3-5,7H,2,10H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t5-,7-/m0/s1 InChIKey: FRJIAZKQGSCKPQ-FSPLSTOPSA-N Inhibitor of Alanine carboxypeptidase (EC 3.4.17.6) (MEROPS ID: M9E.002) according to the BRENDA database |
Database reference: |
BRENDA: Ligand His-Ala ChEBI: ID 73924 ChEMBL: ID CHEMBL2371149 ChemIDplus: ID 016874752 Chemspider: ID 91418 EROP-Moscow: ID E09226 FeptideDB: ID 3184 FooDB: ID FDB111907 HMDB: ID HMDB00288 J-GLOBAL: ID 200907054943405371 MeSH: term histidinoalanine MetaboLights: ID MTBLC73924 Nikkaji: ID J150.401K PubChem: CID 101180 SureChEMBL: ID SCHEMBL5077779 ZINC: ID ZINC000001605278 |