BIOPEP-UWM: Report
| ID | 3186 |
| Name | derivative of Leu-enkephalin |
| sequence |
| Function: | |||
| Opioid | |||
| Number of residues | 7 |
Activity code | op |
| Activity : | opioid |
|||
| Chemical mass | 786.8761 | Monoisotopic mass | 786.4125 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Malfroy B., Swerts J. P., Guyon A., Rogues B. P., Schwartz J. C. | |
| Title | |
| High-affinity enkephalin-degrading peptidase in brain is increased after morphine. Nature, 276, 523-526, 1978 | |
| Year | Source |
| 1978 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [C@@H](CCCNC(N)=N)(NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)CNC(=O)CN)[C@@H](C)O)C(=O)N[C@@H](CC2=CN=C[N]2)C(O)=O InChI=1S/C35H54N12O9/c1-19(2)12-24(45-31(52)25(13-21-8-5-4-6-9-21)43-28(50)17-41-27(49)15-36)32(53)47-29(20(3)48)33(54)44-23(10-7-11-40-35(37)38)30(51)46-26(34(55)56)14-22-16-39-18-42-22/h4-6,8-9,16,18-20,23-26,29,48H,7,10-15,17,36H2,1-3H3,(H,39,42)(H,41,49)(H,43,50)(H,44,54)(H,45,52)(H,46,51)(H,47,53)(H,55,56)(H4,37,38,40)/t20-,23+,24+,25+,26+,29+/m1/s1 InChIKey=RZPMCNCUPXAQPS-KLDTUEQLSA-N |
| Database reference: |