BIOPEP-UWM: Report
| ID | 3191 |
| Name | copper binding peptide |
| sequence |
| Function: | |||
| copper binding | |||
| Number of residues | 6 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 663.6844 | Monoisotopic mass | 663.3193 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lau S. J., Kruch T. P. A., Sarkar B. | |
| Title | |
| A peptide molecule mimicking the copper (II) transport site of human serum albumin. J. Biol. Chem., 249, 5878-5884, 1974 | |
| Year | Source |
| 1974 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CC1=CN=CN1)(NC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)[C@@]([H])(NC(=O)[C@]([H])(CC1=CN=CN1)NC(=O)CNC(=O)CN)[C@@H](C)O)C(O)=O InChI=1S/C26H41N13O8/c1-13(40)21(39-23(44)17(5-14-8-30-11-34-14)36-20(42)10-33-19(41)7-27)24(45)37-16(3-2-4-32-26(28)29)22(43)38-18(25(46)47)6-15-9-31-12-35-15/h8-9,11-13,16-18,21,40H,2-7,10,27H2,1H3,(H,30,34)(H,31,35)(H,33,41)(H,36,42)(H,37,45)(H,38,43)(H,39,44)(H,46,47)(H4,28,29,32)/t13-,16+,17+,18+,21+/m1/s1 InChIKey=JTZRYOOBSWDKPZ-BEACGEKWSA-N |
| Database reference: |