BIOPEP-UWM: Report
| ID | 3193 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 11 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 941.1214 | Monoisotopic mass | 940.5365 | |
| IC50 : | 4.20 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kato H., Suzuki T. | |
| Title | |
| Bradykinin-potentiating peptides from venom of Agkistrodon halys blomhoffi. Isolation of five bradykinin potentiators and amino acid sequences of two of them, potentiators B and C. Biochemistry, 10, 972-980, 1971 | |
| Year | Source |
| 1971 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C46H72N10O11/c1-5-28(4)38(45(65)55-22-10-16-34(55)44(64)56-23-11-17-35(56)46(66)67)50-40(60)31-13-7-20-53(31)42(62)32-14-8-18-51(32)37(58)26-48-39(59)30-12-6-19-52(30)43(63)33-15-9-21-54(33)41(61)29(24-27(2)3)49-36(57)25-47/h27-35,38H,5-26,47H2,1-4H3,(H,48,59)(H,49,57)(H,50,60)(H,66,67)/t28-,29-,30-,31-,32-,33-,34-,35-,38-/m0/s1 InChIKey=UALXDFDEASGIQC-BMBRTWATSA-N |
| Database reference: |
AHTPDB: ID 6916 EROP-Moscow: ID E00089 SATPdb: ID satpdb17670 |