BIOPEP-UWM: Report
| ID | 3199 |
| Name | chymotrypsin inhibitor |
| sequence |
| Function: | |||
| Inhibitor of chymotrypsin A (EC 3.4.21.1) (MEROPS ID: S01.001) | |||
| Number of residues | 4 |
Activity code | inh |
| Activity : | inhibitor |
|||
| Chemical mass | 434.4849 | Monoisotopic mass | 434.2158 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kashima A., Inoue Y., Sugio S., Maeda I., Nose T., Shimohigashi Y. | |
| Title | |
| X-ray crystal structure of a dipeptide-chymotrypsin complex in an inhibitory interaction. Eur. J. Biochem., 255, 12-23, 1998 | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: CC(C)[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O)NC(=O)CNC(=O)[C@@H]2CCCN2 InChI=1S/C21H30N4O6/c1-12(2)18(25-17(27)11-23-19(28)15-4-3-9-22-15)20(29)24-16(21(30)31)10-13-5-7-14(26)8-6-13/h5-8,12,15-16,18,22,26H,3-4,9-11H2,1-2H3,(H,23,28)(H,24,29)(H,25,27)(H,30,31)/t15-,16-,18-/m0/s1 InChIKey=ZBNNBYWPROTERZ-BQFCYCMXSA-N |
| Database reference: |
| ChemSpider: ID ID393351 PubChem: CID 445833 |