BIOPEP-UWM: Report
| ID | 3201 |
| Name | chymotrypsin inhibitor |
| sequence |
| Function: | |||
| Inhibitor of chymotrypsin A (EC 3.4.21.1) (MEROPS ID: S01.001) | |||
| Number of residues | 3 |
Activity code | inh |
| Activity : | inhibitor |
|||
| Chemical mass | 332.3536 | Monoisotopic mass | 332.1480 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kashima A., Inoue Y., Sugio S., Maeda I., Nose T., Shimohigashi Y. | |
| Title | |
| X-ray crystal structure of a dipeptide-chymotrypsin complex in an inhibitory interaction. Eur. J. Biochem., 255, 12-23, 1998 | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)CN)C(=O)N[C@@]([H])(CC1=CNC2=C1C=CC=C2)C(O)=O InChI=1S/C16H20N4O4/c1-9(19-14(21)7-17)15(22)20-13(16(23)24)6-10-8-18-12-5-3-2-4-11(10)12/h2-5,8-9,13,18H,6-7,17H2,1H3,(H,19,21)(H,20,22)(H,23,24)/t9-,13-/m0/s1 InChIKey=LERGJIVJIIODPZ-ZANVPECISA-N |
| Database reference: |
| ChemSpider: ID 4593621 MMDB: ID 3405.2, 54843 PubChem: CID 5496999 |