BIOPEP-UWM: Report
| ID | 3213 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Inhibitor of platelet aggregation | |||
| Number of residues | 11 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 1052.1390 | Monoisotopic mass | 1051.5394 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cierniewski C. S., Byzova T., Papierak M., Haas T. A., Niewiarowska J., Zhang L., Cieslak M., Plow E. F. | |
| Title | |
| Peptide ligands can bind to distinct sites in integrin alphaIIb-beta3 and elicit different functional responses. J Biol. Chem., 274, 16923-16932, 1999 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[N]([H])C=N1)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C44H73N15O15/c1-21(2)13-29(58-39(68)26(46)14-25-16-48-20-52-25)40(69)51-17-32(61)49-18-33(62)53-24(6)38(67)56-27(9-7-8-12-45)42(71)57-28(10-11-31(47)60)41(70)54-23(5)37(66)50-19-34(63)55-30(15-35(64)65)43(72)59-36(22(3)4)44(73)74/h16,20-24,26-30,36H,7-15,17-19,45-46H2,1-6H3,(H2,47,60)(H,48,52)(H,49,61)(H,50,66)(H,51,69)(H,53,62)(H,54,70)(H,55,63)(H,56,67)(H,57,71)(H,58,68)(H,59,72)(H,64,65)(H,73,74)/t23-,24-,26-,27-,28-,29-,30-,36-/m0/s1 InChIKey=CVSUOIMABBJXJG-GGBOURJCSA-N |
| Database reference: |
| PepBank: Peptide HLGGAKQAGDV |