BIOPEP-UWM: Report
| ID | 3214 |
| Name | Casoxin from bovine kappa-casein fr: 35-41 |
| sequence |
| Function: | |||
| Opioid antagonist | |||
| Number of residues | 7 |
Activity code | op2 |
| Activity : | opioid antagonist |
|||
| Chemical mass | 812.8638 | Monoisotopic mass | 812.3692 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chiba H., Yoshikawa M. | |
| Title | |
| Biologically active peptides from food proteins: new opioid peptides from milk proteins. in „Protein tailoring for food and medical uses”, ed. Feeney R. E., Whitaker J. R., Marcel Dekker, New York, 123-153, 1986 | |
| Year | Source |
| 1986 | book |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(N)=O)C(O)=O InChI=1S/C38H52N8O12/c1-20(2)14-26(34(53)44-28(38(57)58)17-31(40)50)42-32(51)18-41-33(52)27(16-22-7-11-24(49)12-8-22)43-35(54)29(19-47)45-36(55)30-4-3-13-46(30)37(56)25(39)15-21-5-9-23(48)10-6-21/h5-12,20,25-30,47-49H,3-4,13-19,39H2,1-2H3,(H2,40,50)(H,41,52)(H,42,51)(H,43,54)(H,44,53)(H,45,55)(H,57,58)/t25-,26-,27-,28-,29-,30-/m0/s1 InChIKey=IJOXXVAUINUDMW-WPMUBMLPSA-N Ileum contracting peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9726) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9726 EROP-Moscow: ID E07423 MBPDB: peptide YPSYGLN PepBank: peptide YPSYGLN PubChem: CID 134825448 |