BIOPEP-UWM: Report
ID | 3241 |
Name | Antibacterial peptide |
sequence |
Function: | |||
Number of residues | 8 |
Activity code | ab |
Activity : | antibacterial |
|||
Chemical mass | 930.9776 | Monoisotopic mass | 930.3739 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Mignogna G., Simmaco M., Kreil G., Barra D. | |
Title | |
Antibacterial and haemolytic peptides containing D-alloisoleucine from the skin of Bombina variegata. EMBO J., 12, 4829-4832, 1993 | |
Year | Source |
1993 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H]([C@H](O)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC1=C[N]([H])C=N1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCSC)C(=O)O InChI=1S/C37H58N10O16S/c1-16(2)29(36(61)44-22(37(62)63)10-11-64-5)47-32(57)21(7-9-26(51)52)43-33(58)23(12-19-14-39-15-40-19)45-34(59)24(13-27(53)54)46-31(56)20(6-8-25(49)50)42-30(55)17(3)41-35(60)28(38)18(4)48/h14-18,20-24,28-29,48H,6-13,38H2,1-5H3,(H,39,40)(H,41,60)(H,42,55)(H,43,58)(H,44,61)(H,45,59)(H,46,56)(H,47,57)(H,49,50)(H,51,52)(H,53,54)(H,62,63)/t17-,18+,20-,21-,22-,23-,24-,28-,29-/m0/s1 InChIKey=LWPTWWMXDLQXNB-GKXNZRRFSA-N |
Database reference: |
PepBank: Peptide TAEDHEVM |