BIOPEP-UWM: Report
| ID | 3244 |
| Name | Antibacterial peptide |
| sequence |
| Function: | |||
| Antibacterial | |||
| Number of residues | 8 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 964.0503 | Monoisotopic mass | 963.4316 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mignogna G., Simmaco M., Kreil G., Barra D. | |
| Title | |
| Antibacterial and haemolytic peptides containing D-alloisoleucine from the skin of Bombina variegata. EMBO J., 12, 4829-4832, 1993 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C38H65N11O16S/c1-17(2)29(36(63)48-24(37(64)65)14-16-66-5)49-34(61)23(10-13-27(55)56)47-31(58)20(7-6-15-42-38(40)41)45-33(60)22(9-12-26(53)54)46-32(59)21(8-11-25(51)52)44-30(57)18(3)43-35(62)28(39)19(4)50/h17-24,28-29,50H,6-16,39H2,1-5H3,(H,43,62)(H,44,57)(H,45,60)(H,46,59)(H,47,58)(H,48,63)(H,49,61)(H,51,52)(H,53,54)(H,55,56)(H,64,65)(H4,40,41,42)/t18-,19+,20-,21-,22-,23-,24-,28-,29-/m0/s1 InChIKey=RZFIZSXAWQYYRE-QPJYFMOMSA-N |
| Database reference: |
| PepBank: Peptide TAEEREVM |