BIOPEP-UWM: Report
| ID | 3260 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 458.5475 | Monoisotopic mass | 458.2731 | |
| IC50 : | 315.30 µM |
|||
| Bibliographic data: | |
| Authors | |
| Suetsuna K., Chen J.-R. | |
| Title | |
| Identification of antihypertensive peptides from peptic digest of two microalgae, Chlorella vulgaris and Spirulina platensis. Marine Biotechnol., 3, 305–309, 2001 | |
| Year | Source |
| 2001 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: [H][C@](N)([C@@H](C)CC)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(O)=O)C(O)=O InChI=1S/C21H38N4O7/c1-7-12(6)15(22)18(28)24-17(11(4)5)20(30)25-16(10(2)3)19(29)23-13(21(31)32)8-9-14(26)27/h10-13,15-17H,7-9,22H2,1-6H3,(H,23,29)(H,24,28)(H,25,30)(H,26,27)(H,31,32)/t12-,13-,15-,16-,17-/m0/s1 InChIKey: VLVIDBIIZPQZIW-PTTAZLHSSA-N Information concerning Angiotensin-Converting Enzyme (ACE) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M02-001 |
| Database reference: |
| AHTPDB: ID 1030, 1861 EROP-Moscow: ID E24041 FeptideDB: ID 3260 SATPdb: ID satpdb28242 |