BIOPEP-UWM: Report
| ID | 3272 |
| Name |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 8 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 801.8428 | Monoisotopic mass | 801.3968 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pierschbacher M. D., Ruoslahti E. | |
| Title | |
| Cell attachment activity of fibronectin can be duplicated by small synthetic fragment of the molecule. Nature, 309, 30-33, 1984 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)[C@]1([H])CCCN1C(=O)[C@]([H])(CO)NC(=O)[C@]([H])(CC(O)=O)NC(=O)CNC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)[C@@]([H])(NC(=O)[C@@]([H])(N)C(C)C)[C@@H](C)O)C(O)=O InChI=1S/C32H55N11O13/c1-14(2)23(33)28(52)42-24(16(4)45)29(53)40-17(7-5-9-36-32(34)35)25(49)37-12-21(46)39-18(11-22(47)48)26(50)41-19(13-44)30(54)43-10-6-8-20(43)27(51)38-15(3)31(55)56/h14-20,23-24,44-45H,5-13,33H2,1-4H3,(H,37,49)(H,38,51)(H,39,46)(H,40,53)(H,41,50)(H,42,52)(H,47,48)(H,55,56)(H4,34,35,36)/t15-,16+,17-,18-,19-,20-,23-,24-/m0/s1 InChIKey=VOIZKHRGMRZDMW-UCXHCKEJSA-N |
| Database reference: |
| FeptideDB: ID 3272 |