BIOPEP-UWM: Report
| ID | 3273 |
| Name |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 5 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 490.4671 | Monoisotopic mass | 490.2129 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pierschbacher M. D., Ruoslahti E. | |
| Title | |
| Cell attachment activity of fibronectin can be duplicated by small synthetic fragment of the molecule. Nature, 309, 30-33, 1984 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CO)(NC(=O)[C@]([H])(CC(O)=O)NC(=O)CNC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)CN)C(O)=O InChI=1S/C17H30N8O9/c18-5-11(27)23-8(2-1-3-21-17(19)20)14(31)22-6-12(28)24-9(4-13(29)30)15(32)25-10(7-26)16(33)34/h8-10,26H,1-7,18H2,(H,22,31)(H,23,27)(H,24,28)(H,25,32)(H,29,30)(H,33,34)(H4,19,20,21)/t8-,9-,10-/m0/s1 InChIKey=RGNVSYKVCGAEHK-GUBZILKMSA-N |
| Database reference: |
| FeptideDB: ID 3273 |