BIOPEP-UWM: Report
| ID | 3274 |
| Name |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 5 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 546.5731 | Monoisotopic mass | 546.2753 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pierschbacher M. D., Ruoslahti E. | |
| Title | |
| Cell attachment activity of fibronectin can be duplicated by small synthetic fragment of the molecule. Nature, 309, 30-33, 1984 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(C(C)C)C(=O)N[C@@]([H])([C@@H](C)O)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)NCC(=O)N[C@@]([H])(CC(O)=O)C(O)=O InChI=1S/C21H38N8O9/c1-9(2)15(22)18(35)29-16(10(3)30)19(36)28-11(5-4-6-25-21(23)24)17(34)26-8-13(31)27-12(20(37)38)7-14(32)33/h9-12,15-16,30H,4-8,22H2,1-3H3,(H,26,34)(H,27,31)(H,28,36)(H,29,35)(H,32,33)(H,37,38)(H4,23,24,25)/t10-,11+,12+,15+,16+/m1/s1 InChIKey=WGSSXFLZSNRWJJ-BFPXCNAZSA-N |
| Database reference: |
| FeptideDB: ID 3274 |