BIOPEP-UWM: Report
| ID | 3277 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 4 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 560.5996 | Monoisotopic mass | 560.2909 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Meddeb S., Demaret J., Ballini J. P., Fiat A.-M., Jolles P., Ptak M., Vigny P. | |
| Title | |
| A conformational study of Lys-Arg-Asp-Ser and analogs, a series of potent antithrombotic peptide. An approach based on simulated annealing and 1H-NMR. J. Biomolec. Struct. Dyn., 11, 959-981, 1994 | |
| Year | Source |
| 1994 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])(CCC(O)=O)C(O)=O InChI=1S/C22H40N8O9/c23-10-2-1-4-12(24)18(35)28-13(5-3-11-27-22(25)26)19(36)29-14(6-8-16(31)32)20(37)30-15(21(38)39)7-9-17(33)34/h12-15H,1-11,23-24H2,(H,28,35)(H,29,36)(H,30,37)(H,31,32)(H,33,34)(H,38,39)(H4,25,26,27)/t12-,13-,14-,15-/m0/s1 InChIKey=IAUVFLUYQWRCCI-AJNGGQMLSA-N |
| Database reference: |
| DFBP: ID DFBPANTH0029 FeptideDB: ID 3277 |