BIOPEP-UWM: Report
| ID | 3278 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 4 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 465.5055 | Monoisotopic mass | 465.2442 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Laudano A., Doolittle R. F. | |
| Title | |
| Studies on synthetic peptides that bind to fibrinogen and prevent fibrin polymerization. Structural requirements number of binding sites and species differences. Biochemistry, 19, 1013-1019, 1981 | |
| Year | Source |
| 1981 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCNC(N)=N)(NC(=O)[C@]([H])(CC1=CN=CN1)NC(=O)CN)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C19H31N9O5/c20-8-15(29)26-13(7-11-9-23-10-25-11)16(30)27-12(3-1-5-24-19(21)22)17(31)28-6-2-4-14(28)18(32)33/h9-10,12-14H,1-8,20H2,(H,23,25)(H,26,29)(H,27,30)(H,32,33)(H4,21,22,24)/t12-,13-,14-/m0/s1 InChIKey=YVHCULPWZYVJEK-IHRRRGAJSA-N |
| Database reference: |
| CAS: Registry No 67869-60-7 ChemIDplus: ID 67869-60-7 ChemSpider: ID 114246 DFBP: ID DFBPANTH0030; DFBPANTH0077; DFBPANTH0078; DFBPANTH0080 EPACompTox: ID DTXSID40218102 FeptideDB: ID 3278 MeSH: term glycyl-histidyl-arginyl-proline PubChem: CID 128928 |