BIOPEP-UWM: Report
| ID | 3279 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 9 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 924.0160 | Monoisotopic mass | 923.3367 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Koivunen E., Wang B., Ruoslahti E. | |
| Title | |
| Phage libraries displaying cyclic peptides with different ring sizes: ligand specificities of the RGD-directed integrins. Bio/Technology, 13, 265-270, 1995 | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(N)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)NCC(=O)N[C@@]([H])(CC(O)=O)C(=O)NCC(=O)N[C@@]([H])(CC1=CNC2=C1C=CC=C2)C(=O)N[C@@]([H])(CS)C(=O)NCC(O)=O InChI=1S/C36H53N13O12S2/c1-17(37)30(56)48-25(16-63)35(61)47-21(7-4-8-40-36(38)39)31(57)42-12-27(51)46-23(10-28(52)53)32(58)43-13-26(50)45-22(9-18-11-41-20-6-3-2-5-19(18)20)34(60)49-24(15-62)33(59)44-14-29(54)55/h2-3,5-6,11,17,21-25,41,62-63H,4,7-10,12-16,37H2,1H3,(H,42,57)(H,43,58)(H,44,59)(H,45,50)(H,46,51)(H,47,61)(H,48,56)(H,49,60)(H,52,53)(H,54,55)(H4,38,39,40)/t17-,21-,22-,23-,24-,25-/m0/s1 InChIKey=LSBOIMSDBDWMHR-WFATXQSVSA-N |
| Database reference: |
| DFBP: ID DFBPANTH0031 FeptideDB: ID 3279 |