BIOPEP-UWM: Report
| ID | 3281 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 9 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 1095.2554 | Monoisotopic mass | 1094.4735 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Koivunen E., Wang B., Ruoslahti E. | |
| Title | |
| Phage libraries displaying cyclic peptides with different ring sizes: ligand specificities of the RGD-directed integrins. Bio/Technology, 13, 265-270, 1995 | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CS)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])([C@@H](C)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC1=CNC2=C1C=CC=C2)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CS)C(O)=O InChI=1S/C44H70N16O13S2/c1-20(35(65)59-31(19-75)42(72)73)53-40(70)30(16-23-17-52-26-9-5-4-8-24(23)26)58-34(64)21(2)54-41(71)33(22(3)61)60-39(69)29(12-13-32(62)63)57-38(68)28(11-7-15-51-44(48)49)56-37(67)27(10-6-14-50-43(46)47)55-36(66)25(45)18-74/h4-5,8-9,17,20-22,25,27-31,33,52,61,74-75H,6-7,10-16,18-19,45H2,1-3H3,(H,53,70)(H,54,71)(H,55,66)(H,56,67)(H,57,68)(H,58,64)(H,59,65)(H,60,69)(H,62,63)(H,72,73)(H4,46,47,50)(H4,48,49,51)/t20-,21-,22+,25-,27-,28-,29-,30-,31-,33-/m0/s1 InChIKey=RPZROUKWPVSEGU-DEWZCMAKSA-N |
| Database reference: |
| DFBP: ID DFBPANTH0033 FeptideDB: ID 3281 |