BIOPEP-UWM: Report
ID | 3282 |
Name | Antithrombotic peptide |
sequence |
Function: | |||
Antithrombotic | |||
Number of residues | 6 |
Activity code | at |
Activity : | antithrombotic |
|||
Chemical mass | 624.6484 | Monoisotopic mass | 624.3084 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Koivunen E., Wang B., Ruoslahti E. | |
Title | |
Phage libraries displaying cyclic peptides with different ring sizes: ligand specificities of the RGD-directed integrins. Bio/Technology, 13, 265-270, 1995 | |
Year | Source |
1995 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(N)=O)C(=O)NCC(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC1=CN=CN1)C(=O)N[C@@]([H])(C)C(O)=O InChI=1S/C24H40N12O8/c1-11(19(39)36-16(6-13-8-29-10-32-13)22(42)34-12(2)23(43)44)33-21(41)15(4-3-5-30-24(27)28)35-18(38)9-31-20(40)14(25)7-17(26)37/h8,10-12,14-16H,3-7,9,25H2,1-2H3,(H2,26,37)(H,29,32)(H,31,40)(H,33,41)(H,34,42)(H,35,38)(H,36,39)(H,43,44)(H4,27,28,30)/t11-,12-,14-,15-,16-/m0/s1 InChIKey=OXQDMHOJJYCMTG-OSZUESSQSA-N |
Database reference: |
DFBP: ID DFBPANTH0034 FeptideDB: ID 3282 |