BIOPEP-UWM: Report
| ID | 3287 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 4 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 493.5123 | Monoisotopic mass | 493.2278 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Andrieux A., Hudry-Clergeon G., Ryckewaert J-J., Chapel A., Ginsberg M.H., Plow E.F., Marguerie G. | |
| Title | |
| Amino acid sequences in fibrinogen mediating its interaction with its platelet receptor, GP IIbIIIa. J. Biol. Chem. 264, 9258-9265, 1989 | |
| Year | Source |
| 1989 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C21H31N7O7/c22-13(7-4-8-25-21(23)24)18(32)26-11-16(29)27-14(10-17(30)31)19(33)28-15(20(34)35)9-12-5-2-1-3-6-12/h1-3,5-6,13-15H,4,7-11,22H2,(H,26,32)(H,27,29)(H,28,33)(H,30,31)(H,34,35)(H4,23,24,25)/t13-,14-,15-/m0/s1 InChIKey=ARNGIGOPGOEJCH-KKUMJFAQSA-N |
| Database reference: |
| CAS: Registry No 110697-46-6 ChEMBL: ID CHEMBL303561 ChemIdplus: ID 110697-46-6 ChemSpider: ID 2338691 CTD: ID 110697-46-6 DFBP: ID DFBPANTH0038 eChemPortal: ID 110697-46-6 EPA CompTox: ID DTXSID40149361 FeptideDB: ID 3287 J-GLOBAL ID: 200907052533035302 MeSH: Term arginyl-glycyl-aspartyl-phenylalanine Nikkaji: ID J486.962A PubChem: CID 3080994 ZINC: ID ZINC000003920638 |