BIOPEP-UWM: Report
| ID | 3289 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 10 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 1207.3968 | Monoisotopic mass | 1206.6047 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Andrieux A., Hudry-Clergeon G., Ryckewaert J-J., Chapel A., Ginsberg M.H., Plow E.F., Marguerie G. | |
| Title | |
| Amino acid sequences in fibrinogen mediating its interaction with its platelet receptor, GP IIbIIIa J. Biol. Chem. 264, 9258-9265, 1989 | |
| Year | Source |
| 1989 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C53H86N14O16S/c1-8-28(5)42(66-44(74)31(54)24-38(55)68)50(80)63-34(19-21-84-7)46(76)62-33(17-18-40(70)71)47(77)67-43(29(6)9-2)51(81)64-35(22-27(3)4)48(78)61-32(16-13-20-58-53(56)57)45(75)59-26-39(69)60-36(25-41(72)73)49(79)65-37(52(82)83)23-30-14-11-10-12-15-30/h10-12,14-15,27-29,31-37,42-43H,8-9,13,16-26,54H2,1-7H3,(H2,55,68)(H,59,75)(H,60,69)(H,61,78)(H,62,76)(H,63,80)(H,64,81)(H,65,79)(H,66,74)(H,67,77)(H,70,71)(H,72,73)(H,82,83)(H4,56,57,58)/t28-,29-,31-,32-,33-,34-,35-,36-,37-,42-,43-/m0/s1 InChIKey=MJWWEDCIKOJWAE-CTUYBADWSA-N |
| Database reference: |
| FeptideDB: ID 3289 |