BIOPEP-UWM: Report
| ID | 3304 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 752.8615 | Monoisotopic mass | 752.4071 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen H.-M., Muramoto K., Yamauchi F., Nokihara K. | |
| Title | |
| Antioxidant activity of designed peptides based on the antioxidant peptide isolated from digests of a soybean protein. J. Agric. Food Chem., 44, 2619-2623 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](Cc1c[nH]cn1)C(O)=O InChI=1S/C35H52N12O7/c1-19(2)8-24(36)30(48)45-27(9-20(3)4)34(52)47-7-5-6-29(47)33(51)44-26(11-22-14-38-17-41-22)31(49)43-25(10-21-13-37-16-40-21)32(50)46-28(35(53)54)12-23-15-39-18-42-23/h13-20,24-29H,5-12,36H2,1-4H3,(H,37,40)(H,38,41)(H,39,42)(H,43,49)(H,44,51)(H,45,48)(H,46,50)(H,53,54)/t24-,25-,26-,27-,28-,29-/m0/s1 InChIKey=NXKGZACHEVDLHH-AQRCPPRCSA-N |
| Database reference: |