BIOPEP-UWM: Report
| ID | 3305 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 2 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 268.3114 | Monoisotopic mass | 268.1531 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen H.-M., Muramoto K., Yamauchi F., Nokihara K. | |
| Title | |
| Antioxidant activity of designed peptides based on the antioxidant peptide isolated from digests of a soybean protein. J. Agric. Food Chem., 44, 2619-2623 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CC1=CN=CN1)C(O)=O InChI=1S/C12H20N4O3/c1-7(2)3-9(13)11(17)16-10(12(18)19)4-8-5-14-6-15-8/h5-7,9-10H,3-4,13H2,1-2H3,(H,14,15)(H,16,17)(H,18,19)/t9-,10-/m0/s1 InChIKey=XWOBNBRUDDUEEY-UWVGGRQHSA-N |
| Database reference: |