BIOPEP-UWM: Report
| ID | 3306 |
| Name |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 502.5653 | Monoisotopic mass | 502.2645 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen H.-M., Muramoto K., Yamauchi F., Nokihara K. | |
| Title | |
| Antioxidant activity of designed peptides based on the antioxidant peptide isolated from digests of a soybean protein. J. Agric. Food Chem., 44, 2619-2623, 1996 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC1=CN=CN1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC1=CN=CN1)C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C23H34N8O5/c1-13(2)6-18(23(35)36)30-20(32)17(8-15-10-26-12-28-15)29-21(33)19-4-3-5-31(19)22(34)16(24)7-14-9-25-11-27-14/h9-13,16-19H,3-8,24H2,1-2H3,(H,25,27)(H,26,28)(H,29,33)(H,30,32)(H,35,36)/t16-,17-,18-,19-/m0/s1 InChIKey=DDIWVXMKGLAOHN-VJANTYMQSA-N |
| Database reference: |
| FeptideDB: ID 3306 |