BIOPEP-UWM: Report
| ID | 3307 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 441.4759 | Monoisotopic mass | 441.1893 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen H.-M., Muramoto K., Yamauchi F., Nokihara K. | |
| Title | |
| Antioxidant activity of designed peptides based on the antioxidant peptide isolated from digests of a soybean protein. J. Agric. Food Chem., 44, 2619-2623 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](Cc1ccc(O)cc1)(NC(=O)[C@]([H])(Cc1ccc(O)cc1)NC(=O)[C@]1([H])CCCN1)C(O)=O InChI=1S/C23H27N3O6/c27-16-7-3-14(4-8-16)12-19(25-21(29)18-2-1-11-24-18)22(30)26-20(23(31)32)13-15-5-9-17(28)10-6-15/h3-10,18-20,24,27-28H,1-2,11-13H2,(H,25,29)(H,26,30)(H,31,32)/t18-,19-,20-/m0/s1 InChIKey=QDDJNKWPTJHROJ-UFYCRDLUSA-N |
| Database reference: |