BIOPEP-UWM: Report
| ID | 3314 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 478.5835 | Monoisotopic mass | 478.2895 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen H.-M., Muramoto K., Yamauchi F., Nokihara K. | |
| Title | |
| Antioxidant activity of designed peptides based on the antioxidant peptide isolated from digests of a soybean protein. J. Agric. Food Chem., 44, 2619-2623 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC1=CN=CN1)C(O)=O InChI=1S/C23H38N6O5/c1-13(2)8-16(24)20(30)27-17(9-14(3)4)22(32)29-7-5-6-19(29)21(31)28-18(23(33)34)10-15-11-25-12-26-15/h11-14,16-19H,5-10,24H2,1-4H3,(H,25,26)(H,27,30)(H,28,31)(H,33,34)/t16-,17-,18-,19-/m0/s1 InChIKey=GNLHHORZQJMUCS-VJANTYMQSA-N |
| Database reference: |