BIOPEP-UWM: Report
| ID | 3321 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 745.9464 | Monoisotopic mass | 745.4723 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wei E. T., Thomas H. A. | |
| Title | |
| Anti-inflammatory peptide agonists. Annu. Rev. Pharmacol. Toxicol., 33, 91-108 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C38H63N7O8/c1-7-23(5)31(36(50)42-29(38(52)53)20-22(3)4)43-34(48)28(21-25-14-16-26(46)17-15-25)41-35(49)30-13-11-19-45(30)37(51)32(24(6)8-2)44-33(47)27(40)12-9-10-18-39/h14-17,22-24,27-32,46H,7-13,18-21,39-40H2,1-6H3,(H,41,49)(H,42,50)(H,43,48)(H,44,47)(H,52,53)/t23-,24-,27-,28-,29-,30-,31-,32-/m0/s1 InChIKey=RZMLVIHXZGQADB-YLUGYNJDSA-N |
| Database reference: |