BIOPEP-UWM: Report
| ID | 3322 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 816.9878 | Monoisotopic mass | 816.4956 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wei E. T., Thomas H. A. | |
| Title | |
| Anti-inflammatory peptide agonists. Annu. Rev. Pharmacol. Toxicol., 33, 91-108 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C38H64N12O8/c1-5-22(4)30(34(55)48-28(36(57)58)19-21(2)3)49-32(53)27(20-23-12-14-24(51)15-13-23)47-33(54)29-11-8-18-50(29)35(56)26(10-7-17-45-38(42)43)46-31(52)25(39)9-6-16-44-37(40)41/h12-15,21-22,25-30,51H,5-11,16-20,39H2,1-4H3,(H,46,52)(H,47,54)(H,48,55)(H,49,53)(H,57,58)(H4,40,41,44)(H4,42,43,45)/t22-,25-,26-,27-,28-,29-,30-/m0/s1 InChIKey=DQDBCHHEIKQPJD-ODKJCKIQSA-N |
| Database reference: |