BIOPEP-UWM: Report
| ID | 3324 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 9 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 1084.2447 | Monoisotopic mass | 1083.5365 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Miele L., Cordella-Miele E., Fachiano A., Mukherjee A. B. | |
| Title | |
| Novel anti inflammatory peptides from region of high similarity between uteroglobin and lipocortin I. Nature, 335, 726-730 | |
| Year | Source |
| 1988 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC1=CN=CN1)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C46H77N13O15S/c1-22(2)14-29(41(68)56-32(19-36(63)64)44(71)58-33(46(73)74)15-23(3)4)57-45(72)37(24(5)6)59-40(67)27(10-8-9-12-47)52-42(69)30(17-34(49)60)55-39(66)28(11-13-75-7)53-43(70)31(18-35(61)62)54-38(65)26(48)16-25-20-50-21-51-25/h20-24,26-33,37H,8-19,47-48H2,1-7H3,(H2,49,60)(H,50,51)(H,52,69)(H,53,70)(H,54,65)(H,55,66)(H,56,68)(H,57,72)(H,58,71)(H,59,67)(H,61,62)(H,63,64)(H,73,74)/t26-,27-,28-,29-,30-,31-,32-,33-,37-/m0/s1 InChIKey=MSFJEXCKZQTGKA-KSALCKNPSA-N |
| Database reference: |