BIOPEP-UWM: Report
| ID | 3328 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 590.5826 | Monoisotopic mass | 590.2651 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hamburger R. N. | |
| Title | |
| Peptide inhibition of Prausnitz-Küstner reaction. Science, 189, 389-390 | |
| Year | Source |
| 1975 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(O)=O)C(=O)N[C@@]([H])([C@@H](C)O)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(O)=O InChI=1S/C22H38N8O11/c1-9(17(36)29-13(21(40)41)4-3-7-26-22(24)25)27-19(38)12(5-6-14(32)33)28-20(39)16(10(2)31)30-18(37)11(23)8-15(34)35/h9-13,16,31H,3-8,23H2,1-2H3,(H,27,38)(H,28,39)(H,29,36)(H,30,37)(H,32,33)(H,34,35)(H,40,41)(H4,24,25,26)/t9-,10+,11-,12-,13-,16-/m0/s1 InChIKey=FCXZEMPODMZRRN-QWXXZGNOSA-N |
| Database reference: |