BIOPEP-UWM: Report
| ID | 3332 |
| Name | human beta-casein fr. 57-61 |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 577.6680 | Monoisotopic mass | 577.3101 | |
| EC50 : | 41.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kohmura M., Nio N., Ariyoshi Y. | |
| Title | |
| Inhibition of angiotensin-converting enzyme by synthetic peptide fragments of various beta-caseins. Agric. Biol. Chem., 54, 1101-1102, 1990 | |
| Year | Source |
| 1990 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C28H43N5O8/c1-15(2)12-20(30-24(36)19(29)14-34)25(37)32-23(16(3)4)26(38)31-21(13-17-7-9-18(35)10-8-17)27(39)33-11-5-6-22(33)28(40)41/h7-10,15-16,19-23,34-35H,5-6,11-14,29H2,1-4H3,(H,30,36)(H,31,38)(H,32,37)(H,40,41)/t19-,20-,21-,22-,23-/m0/s1 InChIKey=TURVFKAEKRZGOB-VUBDRERZSA-N Information concerning Angiotensin-Converting Enzyme (ACE) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: XM02-001 |
| Database reference: |