BIOPEP-UWM: Report
| ID | 3347 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 726.7715 | Monoisotopic mass | 726.3213 | |
| IC50 : | 62.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yokoyama K., Chiba H., and Yoshikawa M. | |
| Title | |
| Peptide inhibitors for angiotensin I-converting enzyme from thermolysin digest of dried bonito. Biosci. Biotech. Biochem., 56, 1541-1545 | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(O)=O)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C35H46N6O11/c1-19(2)14-25(33(49)40-27(16-21-7-11-23(43)12-8-21)34(50)41-13-3-4-28(41)35(51)52)38-29(44)18-37-32(48)26(15-20-5-9-22(42)10-6-20)39-31(47)24(36)17-30(45)46/h5-12,19,24-28,42-43H,3-4,13-18,36H2,1-2H3,(H,37,48)(H,38,44)(H,39,47)(H,40,49)(H,45,46)(H,51,52)/t24-,25-,26-,27-,28-/m0/s1 InChIKey=LKRJGCZOYWJFTD-XLIKFSOKSA-N Information concerning Angiotensin-Converting Enzyme (ACE) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: XM02-001 |
| Database reference: |