BIOPEP-UWM: Report
| ID | 3350 |
| Name | Stimulating vasoactive substance release |
| sequence |
| Function: | |||
| Stimulating release of vasoactive substance | |||
| Number of residues | 3 |
Activity code | sti |
| Activity : | stimulating |
|||
| Chemical mass | 327.4180 | Monoisotopic mass | 327.2151 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ringseis R., Motthes B., Lehmann V., Becker K., Schöps R., Ulbrich-Hofmann R., Eder K. | |
| Title | |
| Peptides and hydrolysates from casein and soy protein modulate the release of vasoactive substances from human aortic endothelial cells. Biochim. Biophys. Acta Gen. Subj., 1721, 89-97, 2005 | |
| Year | Source |
| 2005 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C16H29N3O4/c1-9(2)8-11(16(22)23)18-14(20)12-6-5-7-19(12)15(21)13(17)10(3)4/h9-13H,5-8,17H2,1-4H3,(H,18,20)(H,22,23)/t11-,12-,13-/m0/s1 InChIKey=NHXZRXLFOBFMDM-AVGNSLFASA-N Inhibitor of Prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) according to the BIOPEP-UWM database of bioactive peptides (ID 3166) Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8347), the BRENDA database, the EROP-Moscow database Inhibitor of Xaa-Pro dipeptidyl-peptidase (EC 3.4.14.11) (MEROPS ID: S15.001) according to the BRENDA database |
| Database reference: |
| ACToR: ID 90614-49-6 BIOPEP-UWM database of bioactive peptides: ID 3166, 8347 BRENDA: Ligand Diprotin B ChemBank: ID KBio3_002896 ChEMBL: ID CHEMBL3039071 ChemSpider: ID 128973 EROP-Moscow: ID E09236 J-GLOBAL: ID 200907065809070136 Nikkaji: ID J168.832D PubChem: CID 7408179 SureChEMBL: ID SCHEMBL3125140 ZINC: ID ZINC000004899506 |