BIOPEP-UWM: Report
| ID | 3352 |
| Name | Antihrombotic peptide |
| sequence |
| Function: | |||
| Number of residues | 3 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 364.4197 | Monoisotopic mass | 364.1201 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hyun K. W., Jeong S. C., Lee D. H., Park J. S., Lee J. S. | |
| Title | |
| Isolation and characterization of a novel platelet aggregation inhibitory peptide from the medicinal mushroom, Inonotus obliquus. Peptides, 27, 1173-1178, 2006 | |
| Year | Source |
| 2006 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC1=CNC2=C1C=CC=C2)C(=O)NCC(=O)N[C@@]([H])(CS)C(O)=O InChI=1S/C16H20N4O4S/c17-11(5-9-6-18-12-4-2-1-3-10(9)12)15(22)19-7-14(21)20-13(8-25)16(23)24/h1-4,6,11,13,18,25H,5,7-8,17H2,(H,19,22)(H,20,21)(H,23,24)/t11-,13-/m0/s1 InChIKey=MHCLIYHJRXZBGJ-AAEUAGOBSA-N |
| Database reference: |