BIOPEP-UWM: Report
| ID | 3355 |
| Name | Stimulating vasoactive substance release |
| sequence |
| Function: | |||
| Number of residues | 3 |
Activity code | sti |
| Activity : | stimulating |
|||
| Chemical mass | 279.2465 | Monoisotopic mass | 279.1062 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ringseis R., Motthes B., Lehmann V., Becker K., Schöps R., Ulbrich-Hofmann R., Eder K. | |
| Title | |
| Peptides and hydrolysates from casein and soy protein modulate the release of vasoactive substances from human aortic endothelial cells. Biochim. Biophys. Acta Gen. Subj., 1721, 89-97, 2005 | |
| Year | Source |
| 2005 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CO)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(O)=O InChI=1S/C9H17N3O7/c10-4(1-13)7(16)11-5(2-14)8(17)12-6(3-15)9(18)19/h4-6,13-15H,1-3,10H2,(H,11,16)(H,12,17)(H,18,19)/t4-,5-,6-/m0/s1 InChIKey=XQJCEKXQUJQNNK-ZLUOBGJFSA-N |
| Database reference: |