BIOPEP-UWM: Report
| ID | 3357 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 727.8058 | Monoisotopic mass | 727.3642 | |
| EC50 : | 27.30 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wako Y., Ishikawa S., Muramoto K. | |
| Title | |
| Angiotensin I-converting enzyme inhibitors in autolysates of squid liver and mantle muscle. Biosci. Biotech. Biochem., 60, 1353-1355, 1996 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)[C@]([H])(CC1=CN=CN1)NC(=O)[C@]1([H])CCCN1C(=O)[C@]([H])(CC(C)C)NC(=O)[C@]([H])(C)NC(=O)[C@]([H])(Cc1ccc(O)cc1)NC(=O)CN)C(O)=O InChI=1S/C34H49N9O9/c1-18(2)12-26(42-29(46)19(3)38-30(47)24(40-28(45)15-35)13-21-7-9-23(44)10-8-21)33(50)43-11-5-6-27(43)32(49)41-25(14-22-16-36-17-37-22)31(48)39-20(4)34(51)52/h7-10,16-20,24-27,44H,5-6,11-15,35H2,1-4H3,(H,36,37)(H,38,47)(H,39,48)(H,40,45)(H,41,49)(H,42,46)(H,51,52)/t19-,20-,24-,25-,26-,27-/m0/s1 InChIKey=UBJDWWUQPGDMRJ-OHZUUNIUSA-N Information concerning Angiotensin-Converting Enzyme (ACE) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: XM02-001 |
| Database reference: |