BIOPEP-UWM: Report
| ID | 3358 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 670.7546 | Monoisotopic mass | 670.3428 | |
| EC50 : | 9.80 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wako Y., Ishikawa S., Muramoto K. | |
| Title | |
| Angiotensin I-converting enzyme inhibitors in autolysates of squid liver and mantle muscle. Biosci. Biotech. Biochem., 60, 1353-1355 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC1=CN=CN1)C(=O)N[C@@]([H])(C)C(O)=O InChI=1S/C32H46N8O8/c1-17(2)12-25(39-27(42)18(3)36-28(43)23(33)13-20-7-9-22(41)10-8-20)31(46)40-11-5-6-26(40)30(45)38-24(14-21-15-34-16-35-21)29(44)37-19(4)32(47)48/h7-10,15-19,23-26,41H,5-6,11-14,33H2,1-4H3,(H,34,35)(H,36,43)(H,37,44)(H,38,45)(H,39,42)(H,47,48)/t18-,19-,23-,24-,25-,26-/m0/s1 InChIKey=KHUGCVPFJKGJAB-AEVZMIFCSA-N Information concerning Angiotensin-Converting Enzyme (ACE) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: XM02-001 |
| Database reference: |