BIOPEP-UWM: Report
| ID | 3393 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 333.3813 | Monoisotopic mass | 333.1683 | |
| IC50 : | 3.80 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Mitachi H., Tanaka H., Tomizuka N., Suzuki H. | |
| Title | |
| Studies on the active site and antihypertensive activity of angiotensin I-converting enzyme inhibitors derived from casein. Agric. Biol. Chem., 51, 1581-1586 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccccc1)C(=O)N[C@@]([H])(C)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C17H23N3O4/c1-11(16(22)20-9-5-8-14(20)17(23)24)19-15(21)13(18)10-12-6-3-2-4-7-12/h2-4,6-7,11,13-14H,5,8-10,18H2,1H3,(H,19,21)(H,23,24)/t11-,13-,14-/m0/s1 InChIKey=QMMRHASQEVCJGR-UBHSHLNASA-N |
| Database reference: |