BIOPEP-UWM: Report
| ID | 3394 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Number of residues | 8 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 970.1180 | Monoisotopic mass | 969.4944 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Nakagomi K., Tomizuka N., Suzuki H. | |
| Title | |
| Angiotensin I-converting enzyme inhibitor derived from an enzymatic hydrolysate of casein. II. Isolation and bradykinin-potentiating activity on the uterus and the ileum of rats. Agric Biol Chem 49, 1405-1409 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccccc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C50H67N9O11/c1-31(2)43(48(67)57-38(28-33-17-8-4-9-18-33)44(63)53-30-41(60)54-37(50(69)70)21-12-13-25-51)58-45(64)36(23-24-42(61)62)55-46(65)39(29-34-19-10-5-11-20-34)56-47(66)40-22-14-26-59(40)49(68)35(52)27-32-15-6-3-7-16-32/h3-11,15-20,31,35-40,43H,12-14,21-30,51-52H2,1-2H3,(H,53,63)(H,54,60)(H,55,65)(H,56,66)(H,57,67)(H,58,64)(H,61,62)(H,69,70)/t35-,36-,37-,38-,39-,40-,43-/m0/s1 InChIKey=RHGGHUOJGJKAPD-GSCWUVFKS |
| Database reference: |