BIOPEP-UWM: Report
| ID | 3419 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 611.7321 | Monoisotopic mass | 611.3744 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Karaki H., Kuwahara M., Sugano S., Doi C., Doi K., Matsumura N., Shimizu T. | |
| Title | |
| Oral administration of peptides derived from bonito bowels decreases blood pressure in spontaneously hypertensive rats. Comp. Biochem. Physiol., 104C, 351- | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(CC)[C@]([H])(N)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(N)=O)C(O)=O InChI=1S/C27H49N9O7/c1-5-15(4)20(29)23(39)33-16(8-6-12-32-27(30)31)25(41)36-13-7-9-18(36)22(38)35-21(14(2)3)24(40)34-17(26(42)43)10-11-19(28)37/h14-18,20-21H,5-13,29H2,1-4H3,(H2,28,37)(H,33,39)(H,34,40)(H,35,38)(H,42,43)(H4,30,31,32)/t15-,16-,17-,18-,20-,21-/m0/s1 InChIKey=JAFYOUPRYNYFED-ZKHIMWLXSA-N |
| Database reference: |