BIOPEP-UWM: Report
| ID | 3420 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 699.7957 | Monoisotopic mass | 699.3693 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Karaki H., Kuwahara M., Sugano S., Doi C., Doi K., Matsumura N., Shimizu T. | |
| Title | |
| Oral administration of peptides derived from bonito bowels decreases blood pressure in spontaneously hypertensive rats. Comp. Biochem. Physiol., 104C, 351- | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCCN)(NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@]1([H])CCCN1C(=O)[C@]([H])(Cc1ccc(O)cc1)NC(=O)[C@@]([H])(NC(=O)CN)C(C)C)C(O)=O InChI=1S/C33H49N9O8/c1-19(2)28(41-27(44)16-35)31(47)40-25(14-20-8-10-22(43)11-9-20)32(48)42-13-5-7-26(42)30(46)39-24(15-21-17-36-18-37-21)29(45)38-23(33(49)50)6-3-4-12-34/h8-11,17-19,23-26,28,43H,3-7,12-16,34-35H2,1-2H3,(H,36,37)(H,38,45)(H,39,46)(H,40,47)(H,41,44)(H,49,50)/t23-,24-,25-,26-,28-/m0/s1 InChIKey=RTKCCHKIDOPIQT-MGAMHGSISA-N |
| Database reference: |