BIOPEP-UWM: Report
| ID | 3425 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Number of residues | 8 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1031.1645 | Monoisotopic mass | 1030.5333 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cushman D. W., Cheung H. S. | |
| Title | |
| Spectrophotometric assay and properties of the angiotensin-converting enzyme from rabbit lung. Biochem. Pharm., 20, 1637-1648 | |
| Year | Source |
| 1971 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(N)=O)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(O)=O InChI=1S/C49H70N14O11/c1-26(2)39(61-42(67)33(12-8-18-55-49(52)53)57-41(66)32(50)23-38(51)65)45(70)58-34(20-29-14-16-31(64)17-15-29)43(68)62-40(27(3)4)46(71)59-35(22-30-24-54-25-56-30)47(72)63-19-9-13-37(63)44(69)60-36(48(73)74)21-28-10-6-5-7-11-28/h5-7,10-11,14-17,24-27,32-37,39-40,64H,8-9,12-13,18-23,50H2,1-4H3,(H2,51,65)(H,54,56)(H,57,66)(H,58,70)(H,59,71)(H,60,69)(H,61,67)(H,62,68)(H,73,74)(H4,52,53,55)/t32-,33-,34-,35-,36-,37-,39-,40-/m0/s1 InChIKey=JYPVVOOBQVVUQV-CGHBYZBKSA-N |
| Database reference: |