BIOPEP-UWM: Report
| ID | 3428 |
| Name |
| sequence |
| Function: | |||
| The authors prepared three peptides derived from the type III connecting segment domain (IIICS) of fibronectin: EILDV, EILDVPST, REDV, and a laminin-related peptide YIGSR. Each peptide inhibited the experimental tumor metastasis of B16-BL6 melanoma, while EILDV had the strongest effect. The peptides conjugated with poly(ethylene glycol) (PEG) were more effective than the unmodified peptides in molar ratio terms. A mixture composed of PEG hybrids with EILDV, REDV and YIGSR significantly inhibited tumor metastasis. | |||
| Number of residues | 8 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 872.9568 | Monoisotopic mass | 872.4475 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yamamoto S., Kaneda Y., Okada N., Nakagawa S., Kubo K., Inoue S., Maeda M., Yamashiro Y. | |
| Title | |
| Antimetastatic effects of synthetic peptides containing the core sequence of the type III connecting segment domain (IIICS). Anti-Cancer Drugs, 5, 424-428 | |
| Year | Source |
| 1994 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@]([H])(CO)NC(=O)[C@]1([H])CCCN1C(=O)[C@@]([H])(NC(=O)[C@]([H])(CC(O)=O)NC(=O)[C@]([H])(CC(C)C)NC(=O)[C@@]([H])(NC(=O)[C@@]([H])(N)CCC(O)=O)[C@@]([H])(C)CC)C(C)C)C(O)=O InChI=1S/C38H64N8O15/c1-8-19(6)29(44-31(53)21(39)11-12-26(49)50)36(58)41-22(14-17(2)3)32(54)40-23(15-27(51)52)33(55)43-28(18(4)5)37(59)46-13-9-10-25(46)35(57)42-24(16-47)34(56)45-30(20(7)48)38(60)61/h17-25,28-30,47-48H,8-16,39H2,1-7H3,(H,40,54)(H,41,58)(H,42,57)(H,43,55)(H,44,53)(H,45,56)(H,49,50)(H,51,52)(H,60,61)/t19-,20+,21-,22-,23-,24-,25-,28-,29-,30-/m0/s1 InChIKey=FLNMCNFAJCMMHI-YGHIGYJTSA-N |
| Database reference: |