BIOPEP-UWM: Report
| ID | 3429 |
| Name |
| sequence |
| Function: | |||
| The authors prepared three peptides derived from the type III connecting segment domain (IIICS) of fibronectin: EILDV, EILDVPST, REDV, and a laminin-related peptide YIGSR. Each peptide inhibited the experimental tumor metastasis of B16-BL6 melanoma, while EILDV had the strongest effect. The peptides conjugated with poly(ethylene glycol) (PEG) were more effective than the unmodified peptides in molar ratio terms. A mixture composed of PEG hybrids with EILDV, REDV and YIGSR significantly inhibited tumor metastasis. | |||
| Number of residues | 5 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 587.6612 | Monoisotopic mass | 587.3155 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yamamoto S., Kaneda Y., Okada N., Nakagawa S., Kubo K., Inoue S., Maeda M., Yamashiro Y. | |
| Title | |
| Antimetastatic effects of synthetic peptides containing the core sequence of the type III connecting segment domain (IIICS). Anti-Cancer Drugs, 5, 424-428 | |
| Year | Source |
| 1994 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCC(O)=O)C(=O)N[C@]([H])(C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(C(C)C)C(O)=O)[C@@]([H])(C)CC InChI=1S/C26H45N5O10/c1-7-14(6)21(31-22(36)15(27)8-9-18(32)33)25(39)29-16(10-12(2)3)23(37)28-17(11-19(34)35)24(38)30-20(13(4)5)26(40)41/h12-17,20-21H,7-11,27H2,1-6H3,(H,28,37)(H,29,39)(H,30,38)(H,31,36)(H,32,33)(H,34,35)(H,40,41)/t14-,15-,16-,17-,20-,21-/m0/s1 InChIKey=VPKCCODFKUZEMT-KZVLABISSA-N |
| Database reference: |