BIOPEP-UWM: Report
| ID | 3430 |
| Name |
| sequence |
| Function: | |||
| fragment 144-151 of p21WAF1 protein. 20-residue peptide containing this sequence inhibited replication of simian virus 40 (SV40) DNA in vitro and could capture PCNA from whole cell extracts, demonstrating that small molecules can retain the biological activity characteristic of the whole protein. | |||
| Number of residues | 8 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 992.0588 | Monoisotopic mass | 991.3942 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Warbrick E., Lane D. P., Glover D. M., Cox L. S. | |
| Title | |
| A small peptide inhibitor of DNA replication defines the site of interaction between the cyclin-dependent kinase inhibitor p21wAF1 and proliferating cell nuclear antigen. Curr. Biol., 5, 275-282 | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@@]([H])(N)CCC(N)=O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@]([H])(C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(O)=O)[C@@]([H])(C)O InChI=1S/C43H61N9O16S/c1-21(54)34(51-36(60)26(44)13-14-32(45)57)42(66)50-31(20-53)40(64)46-27(15-16-69-3)37(61)52-35(22(2)55)41(65)48-29(19-33(58)59)39(63)47-28(17-23-7-5-4-6-8-23)38(62)49-30(43(67)68)18-24-9-11-25(56)12-10-24/h4-12,21-22,26-31,34-35,53-56H,13-20,44H2,1-3H3,(H2,45,57)(H,46,64)(H,47,63)(H,48,65)(H,49,62)(H,50,66)(H,51,60)(H,52,61)(H,58,59)(H,67,68)/t21-,22-,26+,27+,28+,29+,30+,31+,34+,35+/m1/s1 InChIKey=YEQCAZODHJHSID-VFVAYWGWSA-N |
| Database reference: |