BIOPEP-UWM: Report
| ID | 3437 |
| Name | f(1-8) of bovine lactoferrin |
| sequence |
| Function: | |||
| Number of residues | 8 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1026.1926 | Monoisotopic mass | 1025.5867 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Recio I., Gommans P. G. M., Slangen C. J., Visser S. | |
| Title | |
| Production of antibacterial peptides from biological fluids. Abstracts of Communications of the European Dairy Experts Symposium, Arnhem, 65 | |
| Year | Source |
| 1998 | Conference proceedings |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(N)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O InChI=1S/C46H75N17O10/c1-24(2)36(42(70)59-31(15-9-19-55-46(52)53)39(67)61-33(44(72)73)21-26-23-56-28-12-5-4-11-27(26)28)62-40(68)32(22-35(49)64)60-38(66)29(13-6-7-17-47)57-37(65)30(14-8-18-54-45(50)51)58-41(69)34-16-10-20-63(34)43(71)25(3)48/h4-5,11-12,23-25,29-34,36,56H,6-10,13-22,47-48H2,1-3H3,(H2,49,64)(H,57,65)(H,58,69)(H,59,70)(H,60,66)(H,61,67)(H,62,68)(H,72,73)(H4,50,51,54)(H4,52,53,55)/t25-,29-,30-,31-,32-,33-,34-,36-/m0/s1 InChIKey=UPDWWDAKTXRPBX-PHZYDTLWSA-N |
| Database reference: |