BIOPEP-UWM: Report
| ID | 3462 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 286.2837 | Monoisotopic mass | 286.1273 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ashmarin I. P., Karazeeva E. P., Lyapina L. A., Samonina G. E. | |
| Title | |
| The simplest proline-containing peptides PG, GP, PGP and GPGG: regulatory activity and possible source of biosynthesis. Biochemistry-Moscow, 63, 119-124 | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@]1(CCCN1C(=O)CN)C(=O)NCC(=O)NCC(O)=O InChI=1S/C11H18N4O5/c12-4-9(17)15-3-1-2-7(15)11(20)14-5-8(16)13-6-10(18)19/h7H,1-6,12H2,(H,13,16)(H,14,20)(H,18,19)/t7-/m0/s1 InChIKey=PEZMQPADLFXCJJ-ZETCQYMHSA-N Peptide regulating the stomach mucosal membrane activity according to the BIOPEP-UWM database of bioactive peptides ( ID 2755); Inhibitor of Prolyl Endopeptidase (PEP) (EC 3.4.21.26) (MEROPS ID: S09.001) according to the BIOPEP-UWM database of bioactive peptides (ID 3458) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 2755; 3458 ChemIDplus: ID 013054030 ChemSpider: ID 87411 PubChem: CID 96811 ZINC: ID ZINC04545910 |