BIOPEP-UWM: Report
| ID | 3468 |
| Name | analogue of fibronectin |
| sequence |
| Function: | |||
| Number of residues | 7 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 715.7538 | Monoisotopic mass | 715.3602 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pytela R., Pierschbacher M. D., Ginsberg M. H., Plow E. F., Ruoslahti E. | |
| Title | |
| Platelet membrane glycoprotein IIb/IIIa: member of family Arg-gly-asp-specific adhesion receptors. Science, 231, 1559-1562 | |
| Year | Source |
| 1986 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCCN)(NC(=O)[C@]1([H])CCCN1C(=O)[C@]([H])(CO)NC(=O)[C@]([H])(CC(O)=O)NC(=O)CNC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)CN)C(O)=O InChI=1S/C28H49N11O11/c29-8-2-1-5-16(27(49)50)37-25(47)19-7-4-10-39(19)26(48)18(14-40)38-24(46)17(11-22(43)44)36-21(42)13-34-23(45)15(35-20(41)12-30)6-3-9-33-28(31)32/h15-19,40H,1-14,29-30H2,(H,34,45)(H,35,41)(H,36,42)(H,37,47)(H,38,46)(H,43,44)(H,49,50)(H4,31,32,33)/t15-,16-,17-,18-,19-/m0/s1 InChIKey=ZRVZOBGMZWVJOS-VMXHOPILSA-N |
| Database reference: |