BIOPEP-UWM: Report
| ID | 3473 |
| Name | alpha-casomorphin (90-96) |
| sequence |
| Function: | |||
| Opioid agonist | |||
| Number of residues | 7 |
Activity code | op1 |
| Activity : | opioid agonist |
|||
| Chemical mass | 913.0255 | Monoisotopic mass | 912.4690 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Loukas S., Varoucha D., Zioudrou C., Streaty R. A., Klee W. A. | |
| Title | |
| Opioid activities and structures of alpha-casein-derived exorphins. Biochemistry, 22, 4567-4573, 1983 | |
| Year | Source |
| 1983 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(O)=O)C(O)=O InChI=1S/C43H64N10O12/c1-23(2)18-31(52-41(63)34(21-26-9-13-28(55)14-10-26)51-37(59)29(44)6-5-17-47-43(45)46)38(60)48-22-35(56)49-33(20-25-7-11-27(54)12-8-25)40(62)53-32(19-24(3)4)39(61)50-30(42(64)65)15-16-36(57)58/h7-14,23-24,29-34,54-55H,5-6,15-22,44H2,1-4H3,(H,48,60)(H,49,56)(H,50,61)(H,51,59)(H,52,63)(H,53,62)(H,57,58)(H,64,65)(H4,45,46,47)/t29-,30-,31-,32-,33-,34-/m0/s1 InChIKey=KZPMXRDAPJXTRU-CVUOCSEZSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10055); the MBPDB database Anticancer peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9174); the MBPDB database |
| Database reference: |
| BioPepDB: ID biopep04747 BIOPEP-UWM database of bioactive peptides: ID 9174; 10055 ChemSpider ID8073334 EROP-Moscow: ID E00397 FeptideDB: ID 3473 J-GLOBAL: ID 200907081197875550 MBPDB: Peptide RYLGYLE Nikkaji: ID J448.885G PepBank: Peptide RYLGYLE PubChem: CID 9897674 |