BIOPEP-UWM: Report
| ID | 3488 |
| Name | ACE inhibitor from sake lees |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 367.3976 | Monoisotopic mass | 367.1527 | |
| IC50 : | 10.50 µM |
|||
| Bibliographic data: | |
| Authors | |
| Saito Y., Wanezaki K., Kawato A., Imayasu S. | |
| Title | |
| Structure and activity of angiotensin I converting enzyme inhibitory peptides from sake and sake lees. Biosci. Biotech. Biochem. 58(10), 1767-1771 (1994) | |
| Year | Source |
| 1994 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC1=CC=C(O)C=C1)C(=O)N[C@@H](CC1=CNC2=CC=CC=C12)C(O)=O InChI=1S/C20H21N3O4/c21-16(9-12-5-7-14(24)8-6-12)19(25)23-18(20(26)27)10-13-11-22-17-4-2-1-3-15(13)17/h1-8,11,16,18,22,24H,9-10,21H2,(H,23,25)(H,26,27)/t16-,18-/m0/s1 InChIKey=BMPPMAOOKQJYIP-WMZOPIPTSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8947) Anti-inflammatory peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9868) |
| Database reference: |
| AHTPDB: ID 2047, ahtpdb_2061, ahtpdb_2084, ahtpdb_2240, 3299, 4058, 4135, 4244, 4739, 4943, 4944, 5186, 5569, 6149, 6407, BindingDB: ID 50188527 BiopepDB: ID biopep01644 BIOPEP-UWM database of bioactive peptides: ID 8947; 9868 BRENDA: Ligand Tyr-Trp ChEBI: ID 75006 ChEMBL: ID CHEMBL210851 ChemSpider: ID 5384728 EROP-Moscow: ID E09049 FeptideDB: ID 3488; 8947 J-GLOBAL: ID 200907017536979492 Metabolights: ID MTBLC75006 Nikkaji: ID J258.523E PlantPepDB: ID PPepDB_2963 PubChem: CID 7021832 SATPdb: ID satpdb26243 SureChEMBL: ID SCHEMBL9852041 ZINC: ID ZINC000002575132 |